N-(6-Chloro-2-pyridinyl)-N,N-diethylamine
Microchem by AlphaTec Chemical Permeation Guide 20
Chemical Permeation Guide What is permeation? Permeation is the process by which a potentially hazardous chemical moves through a material on a molecular level. Molecules of chemical adsorb onto the outer surface of the material. They then enter a...
Ansell Chemical Glove Resistance Guide Aug 2016
CHEMICAL GLOVE RESISTANCE GUIDE DEFINITION OF KEY TERMS Permeation is a process by which a chemical can pass through a protective film without going through pinholes pores or other visible openings. Individual molecules of the chemical enter the f...